C20H38O9 — CID 87460591
2-[2-[2-[3-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]but-1-en-2-yloxy]but-3-enoxy]ethoxy]ethoxy]ethanol (PubChem CID 87460591) has the molecular formula C20H38O9 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2-[2-[2-[3-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]but-1-en-2-yloxy]but-3-enoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[3-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]but-1-en-2-yloxy]but-3-enoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 87460591 |
| Molecular Formula | C20H38O9 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[2-[2-[3-[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]but-1-en-2-yloxy]but-3-enoxy]ethoxy]ethoxy]ethanol |
| SMILES | C=C(CCOCCOCCOCCO)OC(=C)CCOCCOCCOCCO |
| InChI | InChI=1S/C20H38O9/c1-19(3-7-23-11-15-27-17-13-25-9-5-21)29-20(2)4-8-24-12-16-28-18-14-26-10-6-22/h21-22H,1-18H2 |
| InChIKey | VGVFEELJOWWGJT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|