C6H11NO3 — CID 166795800
2-(3-nitrosobut-3-enoxy)ethanol (PubChem CID 166795800) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 2-(3-nitrosobut-3-enoxy)ethanol.
| Compound Name | 2-(3-nitrosobut-3-enoxy)ethanol |
|---|---|
| PubChem CID | 166795800 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-(3-nitrosobut-3-enoxy)ethanol |
| SMILES | C=C(CCOCCO)N=O |
| InChI | InChI=1S/C6H11NO3/c1-6(7-9)2-4-10-5-3-8/h8H,1-5H2 |
| InChIKey | HCMMXUSFJPIMOG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|