C9H8F6 — CID 143562192
(3Z)-3-methyl-2,5-bis(trifluoromethyl)hexa-1,3,5-triene (PubChem CID 143562192) has the molecular formula C9H8F6 and a molecular weight of 230.15 g/mol. Its IUPAC name is (3Z)-3-methyl-2,5-bis(trifluoromethyl)hexa-1,3,5-triene.
| Compound Name | (3Z)-3-methyl-2,5-bis(trifluoromethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143562192 |
| Molecular Formula | C9H8F6 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (3Z)-3-methyl-2,5-bis(trifluoromethyl)hexa-1,3,5-triene |
| SMILES | C=C(/C=C(/C)C(=C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6/c1-5(7(3)9(13,14)15)4-6(2)8(10,11)12/h4H,2-3H2,1H3/b5-4- |
| InChIKey | RPPHVUSGLONXGI-PLNGDYQASA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|