C7H6ClF3OS — CID 144657251
(3E)-5-(trifluoromethyl)hexa-1,3,5-triene-3-sulfinyl chloride (PubChem CID 144657251) has the molecular formula C7H6ClF3OS and a molecular weight of 230.64 g/mol. Its IUPAC name is (3E)-5-(trifluoromethyl)hexa-1,3,5-triene-3-sulfinyl chloride.
| Compound Name | (3E)-5-(trifluoromethyl)hexa-1,3,5-triene-3-sulfinyl chloride |
|---|---|
| PubChem CID | 144657251 |
| Molecular Formula | C7H6ClF3OS |
| Molecular Weight | 230.64 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | (3E)-5-(trifluoromethyl)hexa-1,3,5-triene-3-sulfinyl chloride |
| SMILES | C=C/C(=C\C(=C)C(F)(F)F)S(=O)Cl |
| InChI | InChI=1S/C7H6ClF3OS/c1-3-6(13(8)12)4-5(2)7(9,10)11/h3-4H,1-2H2/b6-4+ |
| InChIKey | TUBXNTPQEXQBDA-GQCTYLIASA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|