(2,2,2-trifluoroacetyl) prop-2-eneperoxoate

C5H3F3O4 — CID 140517984

IUPAC(2,2,2-trifluoroacetyl) prop-2-eneperoxoate
SMILESC=CC(=O)OOC(=O)C(F)(F)F
InChIInChI=1S/C5H3F3O4/c1-2-3(9)11-12-4(10)5(6,7)8/h2H,1H2
InChIKeyAPTBNRHHLVFPML-UHFFFAOYSA-N
MW184.07 g/mol
LogP0.74
Rot. Bonds1

About (2,2,2-trifluoroacetyl) prop-2-eneperoxoate

(2,2,2-trifluoroacetyl) prop-2-eneperoxoate (PubChem CID 140517984) has the molecular formula C5H3F3O4 and a molecular weight of 184.07 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) prop-2-eneperoxoate.

Molecular Properties

Compound Name(2,2,2-trifluoroacetyl) prop-2-eneperoxoate
PubChem CID140517984
Molecular FormulaC5H3F3O4
Molecular Weight184.07 g/mol
Exact Mass184.00
IUPAC Name(2,2,2-trifluoroacetyl) prop-2-eneperoxoate
SMILESC=CC(=O)OOC(=O)C(F)(F)F
InChIInChI=1S/C5H3F3O4/c1-2-3(9)11-12-4(10)5(6,7)8/h2H,1H2
InChIKeyAPTBNRHHLVFPML-UHFFFAOYSA-N
XLogP0.74
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.07
LogP ≤ 50.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze (2,2,2-trifluoroacetyl) prop-2-eneperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,2,2-trifluoroacetyl) prop-2-eneperoxoate?
The IUPAC name of (2,2,2-trifluoroacetyl) prop-2-eneperoxoate (CID 140517984) is (2,2,2-trifluoroacetyl) prop-2-eneperoxoate.
What is the SMILES notation for (2,2,2-trifluoroacetyl) prop-2-eneperoxoate?
The canonical SMILES for (2,2,2-trifluoroacetyl) prop-2-eneperoxoate is C=CC(=O)OOC(=O)C(F)(F)F.
What is the InChIKey of (2,2,2-trifluoroacetyl) prop-2-eneperoxoate?
The InChIKey is APTBNRHHLVFPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3O4/c1-2-3(9)11-12-4(10)5(6,7)8/h2H,1H2.
What are the key properties of (2,2,2-trifluoroacetyl) prop-2-eneperoxoate?
(2,2,2-trifluoroacetyl) prop-2-eneperoxoate has a molecular weight of 184.07 g/mol, XLogP of 0.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trifluoroacetyl) prop-2-eneperoxoate is sourced from PubChem (CID 140517984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).