C7H6F6O4Si — CID 15864568
[ethenyl-methyl-(2,2,2-trifluoroacetyl)oxysilyl] 2,2,2-trifluoroacetate (PubChem CID 15864568) has the molecular formula C7H6F6O4Si and a molecular weight of 296.20 g/mol. Its IUPAC name is [ethenyl-methyl-(2,2,2-trifluoroacetyl)oxysilyl] 2,2,2-trifluoroacetate.
| Compound Name | [ethenyl-methyl-(2,2,2-trifluoroacetyl)oxysilyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 15864568 |
| Molecular Formula | C7H6F6O4Si |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | [ethenyl-methyl-(2,2,2-trifluoroacetyl)oxysilyl] 2,2,2-trifluoroacetate |
| SMILES | C=C[Si](C)(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O4Si/c1-3-18(2,16-4(14)6(8,9)10)17-5(15)7(11,12)13/h3H,1H2,2H3 |
| InChIKey | DDCOIPVXVGGRCJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|