About [ethenyl(dimethyl)silyl] trifluoromethanesulfonate
[ethenyl(dimethyl)silyl] trifluoromethanesulfonate (PubChem CID 53466158) has the molecular formula C5H9F3O3SSi
and a molecular weight of 234.27 g/mol. Its IUPAC name is [ethenyl(dimethyl)silyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [ethenyl(dimethyl)silyl] trifluoromethanesulfonate |
| PubChem CID | 53466158 |
| Molecular Formula | C5H9F3O3SSi |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | [ethenyl(dimethyl)silyl] trifluoromethanesulfonate |
| SMILES | C=C[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H9F3O3SSi/c1-4-13(2,3)11-12(9,10)5(6,7)8/h4H,1H2,2-3H3 |
| InChIKey | RCIVUDHZRWJIFK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [ethenyl(dimethyl)silyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethenyl(dimethyl)silyl] trifluoromethanesulfonate?
The IUPAC name of [ethenyl(dimethyl)silyl] trifluoromethanesulfonate (CID 53466158) is [ethenyl(dimethyl)silyl] trifluoromethanesulfonate.
What is the SMILES notation for [ethenyl(dimethyl)silyl] trifluoromethanesulfonate?
The canonical SMILES for [ethenyl(dimethyl)silyl] trifluoromethanesulfonate is C=C[Si](C)(C)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [ethenyl(dimethyl)silyl] trifluoromethanesulfonate?
The InChIKey is RCIVUDHZRWJIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F3O3SSi/c1-4-13(2,3)11-12(9,10)5(6,7)8/h4H,1H2,2-3H3.
What are the key properties of [ethenyl(dimethyl)silyl] trifluoromethanesulfonate?
[ethenyl(dimethyl)silyl] trifluoromethanesulfonate has a molecular weight of 234.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [ethenyl(dimethyl)silyl] trifluoromethanesulfonate is sourced from PubChem (CID 53466158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).