C16H21F9O6Si — CID 175690446
[decyl-bis[(2,2,2-trifluoroacetyl)oxy]silyl] 2,2,2-trifluoroacetate (PubChem CID 175690446) has the molecular formula C16H21F9O6Si and a molecular weight of 508.41 g/mol. Its IUPAC name is [decyl-bis[(2,2,2-trifluoroacetyl)oxy]silyl] 2,2,2-trifluoroacetate.
| Compound Name | [decyl-bis[(2,2,2-trifluoroacetyl)oxy]silyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175690446 |
| Molecular Formula | C16H21F9O6Si |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [decyl-bis[(2,2,2-trifluoroacetyl)oxy]silyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCCCC[Si](OC(=O)C(F)(F)F)(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H21F9O6Si/c1-2-3-4-5-6-7-8-9-10-32(29-11(26)14(17,18)19,30-12(27)15(20,21)22)31-13(28)16(23,24)25/h2-10H2,1H3 |
| InChIKey | NTEKSMCSTHSKRI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|