C12H24F3NOSi — CID 175690640
2,2,2-trifluoro-N-[heptyl(dimethyl)silyl]-N-methylacetamide (PubChem CID 175690640) has the molecular formula C12H24F3NOSi and a molecular weight of 283.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[heptyl(dimethyl)silyl]-N-methylacetamide.
| Compound Name | 2,2,2-trifluoro-N-[heptyl(dimethyl)silyl]-N-methylacetamide |
|---|---|
| PubChem CID | 175690640 |
| Molecular Formula | C12H24F3NOSi |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[heptyl(dimethyl)silyl]-N-methylacetamide |
| SMILES | CCCCCCC[Si](C)(C)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H24F3NOSi/c1-5-6-7-8-9-10-18(3,4)16(2)11(17)12(13,14)15/h5-10H2,1-4H3 |
| InChIKey | UDNCWVRJKRLTAO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|