C10H13CuF6O2Si — CID 165360048
copper(1+);ethenyl(trimethyl)silane;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate (PubChem CID 165360048) has the molecular formula C10H13CuF6O2Si and a molecular weight of 370.83 g/mol. Its IUPAC name is copper(1+);ethenyl(trimethyl)silane;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate.
| Compound Name | copper(1+);ethenyl(trimethyl)silane;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate |
|---|---|
| PubChem CID | 165360048 |
| Molecular Formula | C10H13CuF6O2Si |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | copper(1+);ethenyl(trimethyl)silane;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate |
| SMILES | C=C[Si](C)(C)C.O=C(/C=C(\[O-])C(F)(F)F)C(F)(F)F.[Cu+] |
| InChI | InChI=1S/C5H2F6O2.C5H12Si.Cu/c6-4(7,8)2(12)1-3(13)5(9,10)11;1-5-6(2,3)4;/h1,12H;5H,1H2,2-4H3;/q;;+1/p-1/b2-1-;; |
| InChIKey | SOLIFJWHTWMEFM-UAIGNFCESA-M |
| XLogP | 2.97 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|