C6F9O6Sb — CID 16685221
bis[(2,2,2-trifluoroacetyl)oxy]stibanyl 2,2,2-trifluoroacetate (PubChem CID 16685221) has the molecular formula C6F9O6Sb and a molecular weight of 460.80 g/mol. Its IUPAC name is bis[(2,2,2-trifluoroacetyl)oxy]stibanyl 2,2,2-trifluoroacetate.
| Compound Name | bis[(2,2,2-trifluoroacetyl)oxy]stibanyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 16685221 |
| Molecular Formula | C6F9O6Sb |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 459.86 |
| IUPAC Name | bis[(2,2,2-trifluoroacetyl)oxy]stibanyl 2,2,2-trifluoroacetate |
| SMILES | O=C(O[Sb](OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/3C2HF3O2.Sb/c3*3-2(4,5)1(6)7;/h3*(H,6,7);/q;;;+3/p-3 |
| InChIKey | QANPOINDJGPROV-UHFFFAOYSA-K |
| XLogP | 1.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|