C8HBF12LiO8- — CID 173195511
lithium;hydride;tetrakis[(2,2,2-trifluoroacetyl)oxy]boranuide (PubChem CID 173195511) has the molecular formula C8HBF12LiO8- and a molecular weight of 470.82 g/mol. Its IUPAC name is lithium;hydride;tetrakis[(2,2,2-trifluoroacetyl)oxy]boranuide.
| Compound Name | lithium;hydride;tetrakis[(2,2,2-trifluoroacetyl)oxy]boranuide |
|---|---|
| PubChem CID | 173195511 |
| Molecular Formula | C8HBF12LiO8- |
| Molecular Weight | 470.82 g/mol |
| Exact Mass | 470.97 |
| IUPAC Name | lithium;hydride;tetrakis[(2,2,2-trifluoroacetyl)oxy]boranuide |
| SMILES | O=C(O[B-](OC(=O)C(F)(F)F)(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C8BF12O8.Li.H/c10-5(11,12)1(22)26-9(27-2(23)6(13,14)15,28-3(24)7(16,17)18)29-4(25)8(19,20)21;;/q-1;+1;-1 |
| InChIKey | CJUUSLRBLKIECD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.82 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|