C6H9NO7S2 — CID 170695241
2-amino-1-oxo-1-prop-2-enoylperoxy-3-sulfanylpropane-2-sulfonic acid (PubChem CID 170695241) has the molecular formula C6H9NO7S2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-amino-1-oxo-1-prop-2-enoylperoxy-3-sulfanylpropane-2-sulfonic acid.
| Compound Name | 2-amino-1-oxo-1-prop-2-enoylperoxy-3-sulfanylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 170695241 |
| Molecular Formula | C6H9NO7S2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 2-amino-1-oxo-1-prop-2-enoylperoxy-3-sulfanylpropane-2-sulfonic acid |
| SMILES | C=CC(=O)OOC(=O)C(N)(CS)S(=O)(=O)O |
| InChI | InChI=1S/C6H9NO7S2/c1-2-4(8)13-14-5(9)6(7,3-15)16(10,11)12/h2,15H,1,3,7H2,(H,10,11,12) |
| InChIKey | OOPMAMXEBLPACY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|