C13H3F19O7 — CID 87618129
[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]acetyl] prop-2-enoate (PubChem CID 87618129) has the molecular formula C13H3F19O7 and a molecular weight of 632.12 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]acetyl] prop-2-enoate.
| Compound Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]acetyl] prop-2-enoate |
|---|---|
| PubChem CID | 87618129 |
| Molecular Formula | C13H3F19O7 |
| Molecular Weight | 632.12 g/mol |
| Exact Mass | 631.96 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]acetyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H3F19O7/c1-2-3(33)35-4(34)5(14,15)36-8(21,22)9(23,24)38-12(29,30)13(31,32)39-11(27,28)10(25,26)37-7(19,20)6(16,17)18/h2H,1H2 |
| InChIKey | JNXGDZFYNPBGGN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.12 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|