C8H9F5O3 — CID 154203238
(3,3,4,4,4-pentafluoro-2-methylbutan-2-yl) prop-2-eneperoxoate (PubChem CID 154203238) has the molecular formula C8H9F5O3 and a molecular weight of 248.15 g/mol. Its IUPAC name is (3,3,4,4,4-pentafluoro-2-methylbutan-2-yl) prop-2-eneperoxoate.
| Compound Name | (3,3,4,4,4-pentafluoro-2-methylbutan-2-yl) prop-2-eneperoxoate |
|---|---|
| PubChem CID | 154203238 |
| Molecular Formula | C8H9F5O3 |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (3,3,4,4,4-pentafluoro-2-methylbutan-2-yl) prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOC(C)(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5O3/c1-4-5(14)15-16-6(2,3)7(9,10)8(11,12)13/h4H,1H2,2-3H3 |
| InChIKey | UFPOALLQPAULNX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|