C15H17N — CID 144813060
(3Z,7Z)-8,9-dimethyl-2,5,6-trimethylidenedeca-3,7,9-trienenitrile (PubChem CID 144813060) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (3Z,7Z)-8,9-dimethyl-2,5,6-trimethylidenedeca-3,7,9-trienenitrile.
| Compound Name | (3Z,7Z)-8,9-dimethyl-2,5,6-trimethylidenedeca-3,7,9-trienenitrile |
|---|---|
| PubChem CID | 144813060 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (3Z,7Z)-8,9-dimethyl-2,5,6-trimethylidenedeca-3,7,9-trienenitrile |
| SMILES | C=C(C#N)/C=C\C(=C)C(=C)/C=C(\C)C(=C)C |
| InChI | InChI=1S/C15H17N/c1-11(2)14(5)9-15(6)13(4)8-7-12(3)10-16/h7-9H,1,3-4,6H2,2,5H3/b8-7-,14-9- |
| InChIKey | ZWXRMHJPFPRNIK-SIBSCAOJSA-N |
| XLogP | 4.26 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|