C16H24 — CID 145064081
(3Z,7Z)-2,3-dimethyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;ethane (PubChem CID 145064081) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (3Z,7Z)-2,3-dimethyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;ethane.
| Compound Name | (3Z,7Z)-2,3-dimethyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;ethane |
|---|---|
| PubChem CID | 145064081 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (3Z,7Z)-2,3-dimethyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;ethane |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C(\C)C(=C)C.CC |
| InChI | InChI=1S/C14H18.C2H6/c1-7-8-9-12(4)14(6)10-13(5)11(2)3;1-2/h7-10H,1-2,4,6H2,3,5H3;1-2H3/b9-8-,13-10-; |
| InChIKey | OSMBBDQFTUCGRS-PYUFWKQTSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|