C20H30O — CID 143236415
ethane;(3Z,7E)-7-ethenyl-2,3,9,10-tetramethyl-5-methylideneundeca-1,3,7,9-tetraen-6-one (PubChem CID 143236415) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is ethane;(3Z,7E)-7-ethenyl-2,3,9,10-tetramethyl-5-methylideneundeca-1,3,7,9-tetraen-6-one.
| Compound Name | ethane;(3Z,7E)-7-ethenyl-2,3,9,10-tetramethyl-5-methylideneundeca-1,3,7,9-tetraen-6-one |
|---|---|
| PubChem CID | 143236415 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | ethane;(3Z,7E)-7-ethenyl-2,3,9,10-tetramethyl-5-methylideneundeca-1,3,7,9-tetraen-6-one |
| SMILES | C=C/C(=C\C(C)=C(C)C)C(=O)C(=C)/C=C(/C)C(=C)C.CC |
| InChI | InChI=1S/C18H24O.C2H6/c1-9-17(11-15(7)13(4)5)18(19)16(8)10-14(6)12(2)3;1-2/h9-11H,1-2,8H2,3-7H3;1-2H3/b14-10-,17-11+; |
| InChIKey | CYFSYAWNAXLJJN-QCGHJXGSSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|