C12H23N — CID 153376220
azane;(3Z)-5-ethenyl-2,3,6-trimethylhepta-1,3,5-triene;molecular hydrogen (PubChem CID 153376220) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is azane;(3Z)-5-ethenyl-2,3,6-trimethylhepta-1,3,5-triene;molecular hydrogen.
| Compound Name | azane;(3Z)-5-ethenyl-2,3,6-trimethylhepta-1,3,5-triene;molecular hydrogen |
|---|---|
| PubChem CID | 153376220 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | azane;(3Z)-5-ethenyl-2,3,6-trimethylhepta-1,3,5-triene;molecular hydrogen |
| SMILES | C=CC(/C=C(/C)C(=C)C)=C(C)C.N.[H][H] |
| InChI | InChI=1S/C12H18.H3N.H2/c1-7-12(10(4)5)8-11(6)9(2)3;;/h7-8H,1-2H2,3-6H3;1H3;1H/b11-8-;; |
| InChIKey | ZDICHWVOSIWQLY-DSMJZMJWSA-N |
| XLogP | 4.44 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|