C11H17N — CID 153376164
(2Z,4Z)-3-ethenyl-5,6-dimethylhepta-2,4,6-trien-2-amine (PubChem CID 153376164) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2Z,4Z)-3-ethenyl-5,6-dimethylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-3-ethenyl-5,6-dimethylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 153376164 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2Z,4Z)-3-ethenyl-5,6-dimethylhepta-2,4,6-trien-2-amine |
| SMILES | C=CC(/C=C(/C)C(=C)C)=C(\C)N |
| InChI | InChI=1S/C11H17N/c1-6-11(10(5)12)7-9(4)8(2)3/h6-7H,1-2,12H2,3-5H3/b9-7-,11-10- |
| InChIKey | HFLOCECPDOHKBB-MNAJIYKBSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|