C6H10O — CID 143116210
(1Z)-2,3-dimethylbuta-1,3-dien-1-ol (PubChem CID 143116210) has the molecular formula C6H10O and a molecular weight of 98.14 g/mol. Its IUPAC name is (1Z)-2,3-dimethylbuta-1,3-dien-1-ol.
| Compound Name | (1Z)-2,3-dimethylbuta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 143116210 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | (1Z)-2,3-dimethylbuta-1,3-dien-1-ol |
| SMILES | C=C(C)/C(C)=C\O |
| InChI | InChI=1S/C6H10O/c1-5(2)6(3)4-7/h4,7H,1H2,2-3H3/b6-4- |
| InChIKey | XPNFMALLOHGDAE-XQRVVYSFSA-N |
| XLogP | 2.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|