About 3-acetylhex-3-ene-2,5-dione
3-acetylhex-3-ene-2,5-dione (PubChem CID 57130396) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3-acetylhex-3-ene-2,5-dione.
Molecular Properties
| Compound Name | 3-acetylhex-3-ene-2,5-dione |
| PubChem CID | 57130396 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-acetylhex-3-ene-2,5-dione |
| SMILES | CC(=O)C=C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C8H10O3/c1-5(9)4-8(6(2)10)7(3)11/h4H,1-3H3 |
| InChIKey | OJVBWWJVFBYPPG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-acetylhex-3-ene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetylhex-3-ene-2,5-dione?
The IUPAC name of 3-acetylhex-3-ene-2,5-dione (CID 57130396) is 3-acetylhex-3-ene-2,5-dione.
What is the SMILES notation for 3-acetylhex-3-ene-2,5-dione?
The canonical SMILES for 3-acetylhex-3-ene-2,5-dione is CC(=O)C=C(C(C)=O)C(C)=O.
What is the InChIKey of 3-acetylhex-3-ene-2,5-dione?
The InChIKey is OJVBWWJVFBYPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-5(9)4-8(6(2)10)7(3)11/h4H,1-3H3.
What are the key properties of 3-acetylhex-3-ene-2,5-dione?
3-acetylhex-3-ene-2,5-dione has a molecular weight of 154.16 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetylhex-3-ene-2,5-dione is sourced from PubChem (CID 57130396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).