C10H18O — CID 143089763
(2Z,4Z)-3-ethyl-6-methoxyhepta-2,4-diene (PubChem CID 143089763) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (2Z,4Z)-3-ethyl-6-methoxyhepta-2,4-diene.
| Compound Name | (2Z,4Z)-3-ethyl-6-methoxyhepta-2,4-diene |
|---|---|
| PubChem CID | 143089763 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (2Z,4Z)-3-ethyl-6-methoxyhepta-2,4-diene |
| SMILES | C/C=C(\C=C/C(C)OC)CC |
| InChI | InChI=1S/C10H18O/c1-5-10(6-2)8-7-9(3)11-4/h5,7-9H,6H2,1-4H3/b8-7-,10-5- |
| InChIKey | DFEBKBPOKFXUHU-JCPYGFQFSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|