C12H20O — CID 88543617
(3Z,5Z)-5-ethyl-2-propan-2-yloxyhepta-1,3,5-triene (PubChem CID 88543617) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3Z,5Z)-5-ethyl-2-propan-2-yloxyhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-5-ethyl-2-propan-2-yloxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 88543617 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3Z,5Z)-5-ethyl-2-propan-2-yloxyhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(=C/C)CC)OC(C)C |
| InChI | InChI=1S/C12H20O/c1-6-12(7-2)9-8-11(5)13-10(3)4/h6,8-10H,5,7H2,1-4H3/b9-8-,12-6- |
| InChIKey | YMSIQKIKOFGSOR-GNXJPQOPSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|