C8H10N2O — CID 146259619
(2Z,4E)-5-methoxy-2-(methylideneamino)hexa-2,4-dienenitrile (PubChem CID 146259619) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is (2Z,4E)-5-methoxy-2-(methylideneamino)hexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-methoxy-2-(methylideneamino)hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 146259619 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (2Z,4E)-5-methoxy-2-(methylideneamino)hexa-2,4-dienenitrile |
| SMILES | C=N/C(C#N)=C\C=C(/C)OC |
| InChI | InChI=1S/C8H10N2O/c1-7(11-3)4-5-8(6-9)10-2/h4-5H,2H2,1,3H3/b7-4+,8-5- |
| InChIKey | VCSSCDCHLHEDJQ-NIQPXEJBSA-N |
| XLogP | 1.64 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|