C9H17N3O2 — CID 90452772
O-[(2E,5E)-4-amino-6-methoxy-5-methyl-6-(methylideneamino)hexa-2,5-dien-2-yl]hydroxylamine (PubChem CID 90452772) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is O-[(2E,5E)-4-amino-6-methoxy-5-methyl-6-(methylideneamino)hexa-2,5-dien-2-yl]hydroxylamine.
| Compound Name | O-[(2E,5E)-4-amino-6-methoxy-5-methyl-6-(methylideneamino)hexa-2,5-dien-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 90452772 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | O-[(2E,5E)-4-amino-6-methoxy-5-methyl-6-(methylideneamino)hexa-2,5-dien-2-yl]hydroxylamine |
| SMILES | C=N/C(OC)=C(/C)C(N)/C=C(\C)ON |
| InChI | InChI=1S/C9H17N3O2/c1-6(14-11)5-8(10)7(2)9(12-3)13-4/h5,8H,3,10-11H2,1-2,4H3/b6-5+,9-7+ |
| InChIKey | QVAVPKAYKFHGGM-SBIWHPGTSA-N |
| XLogP | 0.69 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|