C9H19N3O — CID 90453890
(1E,4E)-1-N,2-dimethyl-5-(methylaminooxy)hexa-1,4-diene-1,3-diamine (PubChem CID 90453890) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (1E,4E)-1-N,2-dimethyl-5-(methylaminooxy)hexa-1,4-diene-1,3-diamine.
| Compound Name | (1E,4E)-1-N,2-dimethyl-5-(methylaminooxy)hexa-1,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 90453890 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (1E,4E)-1-N,2-dimethyl-5-(methylaminooxy)hexa-1,4-diene-1,3-diamine |
| SMILES | CN/C=C(\C)C(N)/C=C(\C)ONC |
| InChI | InChI=1S/C9H19N3O/c1-7(6-11-3)9(10)5-8(2)13-12-4/h5-6,9,11-12H,10H2,1-4H3/b7-6+,8-5+ |
| InChIKey | WJGKYFHSJNTAGV-ZCOYIIAOSA-N |
| XLogP | 0.49 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|