C11H22N4O — CID 90452911
(1Z,4E)-1-N,1-N,2-trimethyl-5-(methylaminooxy)-1-(methylideneamino)hexa-1,4-diene-1,3-diamine (PubChem CID 90452911) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is (1Z,4E)-1-N,1-N,2-trimethyl-5-(methylaminooxy)-1-(methylideneamino)hexa-1,4-diene-1,3-diamine.
| Compound Name | (1Z,4E)-1-N,1-N,2-trimethyl-5-(methylaminooxy)-1-(methylideneamino)hexa-1,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 90452911 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (1Z,4E)-1-N,1-N,2-trimethyl-5-(methylaminooxy)-1-(methylideneamino)hexa-1,4-diene-1,3-diamine |
| SMILES | C=N/C(=C(/C)C(N)/C=C(\C)ONC)N(C)C |
| InChI | InChI=1S/C11H22N4O/c1-8(16-14-4)7-10(12)9(2)11(13-3)15(5)6/h7,10,14H,3,12H2,1-2,4-6H3/b8-7+,11-9+ |
| InChIKey | HYBIABDADKPYIZ-MFDVASPDSA-N |
| XLogP | 0.86 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|