C10H19N3O — CID 90453884
(2R)-2-[[(1Z)-3-amino-2-methyl-1-(methylideneamino)penta-1,4-dienyl]amino]propan-1-ol (PubChem CID 90453884) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is (2R)-2-[[(1Z)-3-amino-2-methyl-1-(methylideneamino)penta-1,4-dienyl]amino]propan-1-ol.
| Compound Name | (2R)-2-[[(1Z)-3-amino-2-methyl-1-(methylideneamino)penta-1,4-dienyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 90453884 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (2R)-2-[[(1Z)-3-amino-2-methyl-1-(methylideneamino)penta-1,4-dienyl]amino]propan-1-ol |
| SMILES | C=CC(N)/C(C)=C(\N=C)N[C@H](C)CO |
| InChI | InChI=1S/C10H19N3O/c1-5-9(11)8(3)10(12-4)13-7(2)6-14/h5,7,9,13-14H,1,4,6,11H2,2-3H3/b10-8+/t7-,9?/m1/s1 |
| InChIKey | CAKGMYJARSWWBF-CXHANMEXSA-N |
| XLogP | 0.40 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|