C7H14N2O3 — CID 145090101
(2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)but-3-enamide (PubChem CID 145090101) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)but-3-enamide.
| Compound Name | (2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)but-3-enamide |
|---|---|
| PubChem CID | 145090101 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2S)-2-amino-N-(1,3-dihydroxypropan-2-yl)but-3-enamide |
| SMILES | C=C[C@H](N)C(=O)NC(CO)CO |
| InChI | InChI=1S/C7H14N2O3/c1-2-6(8)7(12)9-5(3-10)4-11/h2,5-6,10-11H,1,3-4,8H2,(H,9,12)/t6-/m0/s1 |
| InChIKey | VYLFTJWSFVDGSV-LURJTMIESA-N |
| XLogP | -2.03 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|