C5H10N2O2 — CID 88808839
1-hydroxybut-3-en-2-ylurea (PubChem CID 88808839) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is 1-hydroxybut-3-en-2-ylurea.
| Compound Name | 1-hydroxybut-3-en-2-ylurea |
|---|---|
| PubChem CID | 88808839 |
| Molecular Formula | C5H10N2O2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 1-hydroxybut-3-en-2-ylurea |
| SMILES | C=CC(CO)NC(N)=O |
| InChI | InChI=1S/C5H10N2O2/c1-2-4(3-8)7-5(6)9/h2,4,8H,1,3H2,(H3,6,7,9) |
| InChIKey | CEOSQLNYLMHDJK-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|