C10H19NO4 — CID 142796678
ethyl N-(5,5-dimethoxypent-1-en-3-yl)carbamate (PubChem CID 142796678) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is ethyl N-(5,5-dimethoxypent-1-en-3-yl)carbamate.
| Compound Name | ethyl N-(5,5-dimethoxypent-1-en-3-yl)carbamate |
|---|---|
| PubChem CID | 142796678 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | ethyl N-(5,5-dimethoxypent-1-en-3-yl)carbamate |
| SMILES | C=CC(CC(OC)OC)NC(=O)OCC |
| InChI | InChI=1S/C10H19NO4/c1-5-8(7-9(13-3)14-4)11-10(12)15-6-2/h5,8-9H,1,6-7H2,2-4H3,(H,11,12) |
| InChIKey | OPALLKSYYIGEFR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|