C13H23NO8 — CID 11278677
methyl (2R,3S)-2-acetyloxy-3-(ethoxycarbonylamino)-5,5-dimethoxypentanoate (PubChem CID 11278677) has the molecular formula C13H23NO8 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl (2R,3S)-2-acetyloxy-3-(ethoxycarbonylamino)-5,5-dimethoxypentanoate.
| Compound Name | methyl (2R,3S)-2-acetyloxy-3-(ethoxycarbonylamino)-5,5-dimethoxypentanoate |
|---|---|
| PubChem CID | 11278677 |
| Molecular Formula | C13H23NO8 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl (2R,3S)-2-acetyloxy-3-(ethoxycarbonylamino)-5,5-dimethoxypentanoate |
| SMILES | CCOC(=O)N[C@@H](CC(OC)OC)[C@@H](OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C13H23NO8/c1-6-21-13(17)14-9(7-10(18-3)19-4)11(12(16)20-5)22-8(2)15/h9-11H,6-7H2,1-5H3,(H,14,17)/t9-,11+/m0/s1 |
| InChIKey | LBQKORDWVRXAOF-GXSJLCMTSA-N |
| XLogP | 0.21 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|