C10H16F3N5 — CID 162547753
N'-[(1E)-2-amino-1-(dimethylamino)-3-(3,3,3-trifluoroprop-1-en-2-ylamino)buta-1,3-dienyl]methanimidamide (PubChem CID 162547753) has the molecular formula C10H16F3N5 and a molecular weight of 263.27 g/mol. Its IUPAC name is N'-[(1E)-2-amino-1-(dimethylamino)-3-(3,3,3-trifluoroprop-1-en-2-ylamino)buta-1,3-dienyl]methanimidamide.
| Compound Name | N'-[(1E)-2-amino-1-(dimethylamino)-3-(3,3,3-trifluoroprop-1-en-2-ylamino)buta-1,3-dienyl]methanimidamide |
|---|---|
| PubChem CID | 162547753 |
| Molecular Formula | C10H16F3N5 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N'-[(1E)-2-amino-1-(dimethylamino)-3-(3,3,3-trifluoroprop-1-en-2-ylamino)buta-1,3-dienyl]methanimidamide |
| SMILES | C=C(NC(=C)C(F)(F)F)/C(N)=C(\N=CN)N(C)C |
| InChI | InChI=1S/C10H16F3N5/c1-6(17-7(2)10(11,12)13)8(15)9(16-5-14)18(3)4/h5,17H,1-2,15H2,3-4H3,(H2,14,16)/b9-8- |
| InChIKey | UGLWLPFYSGAAKY-HJWRWDBZSA-N |
| XLogP | 0.84 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|