C8H8F3N3OS — CID 162593868
2-cyano-3-methylsulfanyl-3-(3,3,3-trifluoroprop-1-en-2-ylamino)prop-2-enamide (PubChem CID 162593868) has the molecular formula C8H8F3N3OS and a molecular weight of 251.23 g/mol. Its IUPAC name is 2-cyano-3-methylsulfanyl-3-(3,3,3-trifluoroprop-1-en-2-ylamino)prop-2-enamide.
| Compound Name | 2-cyano-3-methylsulfanyl-3-(3,3,3-trifluoroprop-1-en-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 162593868 |
| Molecular Formula | C8H8F3N3OS |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-cyano-3-methylsulfanyl-3-(3,3,3-trifluoroprop-1-en-2-ylamino)prop-2-enamide |
| SMILES | C=C(NC(SC)=C(C#N)C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3OS/c1-4(8(9,10)11)14-7(16-2)5(3-12)6(13)15/h14H,1H2,2H3,(H2,13,15) |
| InChIKey | XGNYCHPIWZWNFJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|