C15H17ClFN3O2S — CID 20849747
(E)-3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-3-(3-methoxypropylamino)prop-2-enamide (PubChem CID 20849747) has the molecular formula C15H17ClFN3O2S and a molecular weight of 357.84 g/mol. Its IUPAC name is (E)-3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-3-(3-methoxypropylamino)prop-2-enamide.
| Compound Name | (E)-3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-3-(3-methoxypropylamino)prop-2-enamide |
|---|---|
| PubChem CID | 20849747 |
| Molecular Formula | C15H17ClFN3O2S |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (E)-3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-3-(3-methoxypropylamino)prop-2-enamide |
| SMILES | COCCCN/C(SCc1c(F)cccc1Cl)=C(/C#N)C(N)=O |
| InChI | InChI=1S/C15H17ClFN3O2S/c1-22-7-3-6-20-15(10(8-18)14(19)21)23-9-11-12(16)4-2-5-13(11)17/h2,4-5,20H,3,6-7,9H2,1H3,(H2,19,21)/b15-10+ |
| InChIKey | AEMHVFCNVZRFNK-XNTDXEJSSA-N |
| XLogP | 2.56 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|