C29H29ClFN3O4S — CID 6618459
3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethoxyanilino)prop-2-enamide (PubChem CID 6618459) has the molecular formula C29H29ClFN3O4S and a molecular weight of 570.09 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethoxyanilino)prop-2-enamide.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethoxyanilino)prop-2-enamide |
|---|---|
| PubChem CID | 6618459 |
| Molecular Formula | C29H29ClFN3O4S |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethoxyanilino)prop-2-enamide |
| SMILES | CCOc1ccccc1NC(SCc1c(F)cccc1Cl)=C(C#N)C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H29ClFN3O4S/c1-4-38-25-11-6-5-10-24(25)34-29(39-18-21-22(30)8-7-9-23(21)31)20(17-32)28(35)33-15-14-19-12-13-26(36-2)27(16-19)37-3/h5-13,16,34H,4,14-15,18H2,1-3H3,(H,33,35) |
| InChIKey | YQKBOBNXWDHUBG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|