C28H28N4O6S — CID 45105787
(E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyanilino)-3-[(3-nitrophenyl)methylsulfanyl]prop-2-enamide (PubChem CID 45105787) has the molecular formula C28H28N4O6S and a molecular weight of 548.62 g/mol. Its IUPAC name is (E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyanilino)-3-[(3-nitrophenyl)methylsulfanyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyanilino)-3-[(3-nitrophenyl)methylsulfanyl]prop-2-enamide |
|---|---|
| PubChem CID | 45105787 |
| Molecular Formula | C28H28N4O6S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | (E)-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(3-methoxyanilino)-3-[(3-nitrophenyl)methylsulfanyl]prop-2-enamide |
| SMILES | COc1cccc(N/C(SCc2cccc([N+](=O)[O-])c2)=C(/C#N)C(=O)NCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H28N4O6S/c1-36-23-9-5-7-21(16-23)31-28(39-18-20-6-4-8-22(14-20)32(34)35)24(17-29)27(33)30-13-12-19-10-11-25(37-2)26(15-19)38-3/h4-11,14-16,31H,12-13,18H2,1-3H3,(H,30,33)/b28-24+ |
| InChIKey | RGZNKSGYMAZWFW-ZZIIXHQDSA-N |
| XLogP | 5.06 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|