C14H19ClFN3O2S — CID 9329015
1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea (PubChem CID 9329015) has the molecular formula C14H19ClFN3O2S and a molecular weight of 347.84 g/mol. Its IUPAC name is 1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea.
| Compound Name | 1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea |
|---|---|
| PubChem CID | 9329015 |
| Molecular Formula | C14H19ClFN3O2S |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea |
| SMILES | COCCCNC(=S)N(C)NC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H19ClFN3O2S/c1-19(14(22)17-7-4-8-21-2)18-13(20)9-10-11(15)5-3-6-12(10)16/h3,5-6H,4,7-9H2,1-2H3,(H,17,22)(H,18,20) |
| InChIKey | VBEAKBKEBJLMTA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|