C15H20Cl2N4O3S — CID 9329121
3,4-dichloro-N-[2-[2-(3-methoxypropylcarbamothioyl)-2-methylhydrazinyl]-2-oxoethyl]benzamide (PubChem CID 9329121) has the molecular formula C15H20Cl2N4O3S and a molecular weight of 407.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[2-(3-methoxypropylcarbamothioyl)-2-methylhydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[2-(3-methoxypropylcarbamothioyl)-2-methylhydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9329121 |
| Molecular Formula | C15H20Cl2N4O3S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3,4-dichloro-N-[2-[2-(3-methoxypropylcarbamothioyl)-2-methylhydrazinyl]-2-oxoethyl]benzamide |
| SMILES | COCCCNC(=S)N(C)NC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N4O3S/c1-21(15(25)18-6-3-7-24-2)20-13(22)9-19-14(23)10-4-5-11(16)12(17)8-10/h4-5,8H,3,6-7,9H2,1-2H3,(H,18,25)(H,19,23)(H,20,22) |
| InChIKey | TTYRZLAGQXCGPO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|