C14H20FN3O3S — CID 9330446
1-[[2-(4-fluorophenoxy)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea (PubChem CID 9330446) has the molecular formula C14H20FN3O3S and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[[2-(4-fluorophenoxy)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea.
| Compound Name | 1-[[2-(4-fluorophenoxy)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea |
|---|---|
| PubChem CID | 9330446 |
| Molecular Formula | C14H20FN3O3S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[[2-(4-fluorophenoxy)acetyl]amino]-3-(3-methoxypropyl)-1-methylthiourea |
| SMILES | COCCCNC(=S)N(C)NC(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3O3S/c1-18(14(22)16-8-3-9-20-2)17-13(19)10-21-12-6-4-11(15)5-7-12/h4-7H,3,8-10H2,1-2H3,(H,16,22)(H,17,19) |
| InChIKey | KMRRZVFHOQJQMR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|