C10H20N4O — CID 118973161
(Z)-3-imino-N,N-dimethyl-5-(methylaminooxy)-1-(methylideneamino)hex-1-en-1-amine (PubChem CID 118973161) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is (Z)-3-imino-N,N-dimethyl-5-(methylaminooxy)-1-(methylideneamino)hex-1-en-1-amine.
| Compound Name | (Z)-3-imino-N,N-dimethyl-5-(methylaminooxy)-1-(methylideneamino)hex-1-en-1-amine |
|---|---|
| PubChem CID | 118973161 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (Z)-3-imino-N,N-dimethyl-5-(methylaminooxy)-1-(methylideneamino)hex-1-en-1-amine |
| SMILES | [H]/N=C(/C=C(\N=C)N(C)C)CC(C)ONC |
| InChI | InChI=1S/C10H20N4O/c1-8(15-13-3)6-9(11)7-10(12-2)14(4)5/h7-8,11,13H,2,6H2,1,3-5H3/b10-7+,11-9+ |
| InChIKey | NBPXTLSVMNMUFW-PPZOTWNKSA-N |
| XLogP | 1.04 |
| TPSA | 60.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|