C10H24N2O — CID 143160692
ethane;N-(2-methoxyethyl)-N,2-dimethylpropanimidamide (PubChem CID 143160692) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)-N,2-dimethylpropanimidamide.
| Compound Name | ethane;N-(2-methoxyethyl)-N,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 143160692 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | ethane;N-(2-methoxyethyl)-N,2-dimethylpropanimidamide |
| SMILES | CC.[H]/N=C(\C(C)C)N(C)CCOC |
| InChI | InChI=1S/C8H18N2O.C2H6/c1-7(2)8(9)10(3)5-6-11-4;1-2/h7,9H,5-6H2,1-4H3;1-2H3/b9-8+; |
| InChIKey | XFSPWHNUMSPKRA-HRNDJLQDSA-N |
| XLogP | 2.22 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|