C9H16O3 — CID 11298226
methyl (E)-2-hydroxy-3,5-dimethylhex-3-enoate (PubChem CID 11298226) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is methyl (E)-2-hydroxy-3,5-dimethylhex-3-enoate.
| Compound Name | methyl (E)-2-hydroxy-3,5-dimethylhex-3-enoate |
|---|---|
| PubChem CID | 11298226 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | methyl (E)-2-hydroxy-3,5-dimethylhex-3-enoate |
| SMILES | COC(=O)C(O)/C(C)=C/C(C)C |
| InChI | InChI=1S/C9H16O3/c1-6(2)5-7(3)8(10)9(11)12-4/h5-6,8,10H,1-4H3/b7-5+ |
| InChIKey | KLSCVVJERJDUCN-FNORWQNLSA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|