C7H12N2O2 — CID 138726910
(Z)-3-methoxy-3-(methylideneamino)-2-(methyliminomethyl)prop-2-en-1-ol (PubChem CID 138726910) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (Z)-3-methoxy-3-(methylideneamino)-2-(methyliminomethyl)prop-2-en-1-ol.
| Compound Name | (Z)-3-methoxy-3-(methylideneamino)-2-(methyliminomethyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 138726910 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (Z)-3-methoxy-3-(methylideneamino)-2-(methyliminomethyl)prop-2-en-1-ol |
| SMILES | C=N/C(OC)=C(\C=N\C)CO |
| InChI | InChI=1S/C7H12N2O2/c1-8-4-6(5-10)7(9-2)11-3/h4,10H,2,5H2,1,3H3/b7-6-,8-4+ |
| InChIKey | JSNOQRRBDVGRIJ-AKAREZBESA-N |
| XLogP | 0.24 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|