C7H13N — CID 123452663
N,2,3-trimethylbut-2-en-1-imine (PubChem CID 123452663) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is N,2,3-trimethylbut-2-en-1-imine.
| Compound Name | N,2,3-trimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 123452663 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | N,2,3-trimethylbut-2-en-1-imine |
| SMILES | C/N=C/C(C)=C(C)C |
| InChI | InChI=1S/C7H13N/c1-6(2)7(3)5-8-4/h5H,1-4H3/b8-5+ |
| InChIKey | AMTIPHYBNHFSKE-VMPITWQZSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|