C12H18N2 — CID 156736104
(3E,5E)-6-methyl-7-methylimino-5-prop-1-en-2-ylhepta-1,3,5-trien-4-amine (PubChem CID 156736104) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3E,5E)-6-methyl-7-methylimino-5-prop-1-en-2-ylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-6-methyl-7-methylimino-5-prop-1-en-2-ylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 156736104 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3E,5E)-6-methyl-7-methylimino-5-prop-1-en-2-ylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C(C(=C)C)=C(C)\C=N\C |
| InChI | InChI=1S/C12H18N2/c1-6-7-11(13)12(9(2)3)10(4)8-14-5/h6-8H,1-2,13H2,3-5H3/b11-7+,12-10+,14-8+ |
| InChIKey | OTATUNHQUWQDGL-BONBLCMCSA-N |
| XLogP | 2.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|