C8H10FN — CID 163583953
(2E)-2-[(E)-2-fluoroethenyl]-N-methylpenta-2,4-dien-1-imine (PubChem CID 163583953) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is (2E)-2-[(E)-2-fluoroethenyl]-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-2-[(E)-2-fluoroethenyl]-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 163583953 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (2E)-2-[(E)-2-fluoroethenyl]-N-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(\C=C\F)/C=N/C |
| InChI | InChI=1S/C8H10FN/c1-3-4-8(5-6-9)7-10-2/h3-7H,1H2,2H3/b6-5+,8-4+,10-7+ |
| InChIKey | GJXGJVHNLNTUIB-AMPMGUEKSA-N |
| XLogP | 2.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|