C14H21ClFN — CID 176951443
(2E,4Z)-4-chloro-5-fluoro-N,2-dimethyl-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine;ethane (PubChem CID 176951443) has the molecular formula C14H21ClFN and a molecular weight of 257.78 g/mol. Its IUPAC name is (2E,4Z)-4-chloro-5-fluoro-N,2-dimethyl-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine;ethane.
| Compound Name | (2E,4Z)-4-chloro-5-fluoro-N,2-dimethyl-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine;ethane |
|---|---|
| PubChem CID | 176951443 |
| Molecular Formula | C14H21ClFN |
| Molecular Weight | 257.78 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (2E,4Z)-4-chloro-5-fluoro-N,2-dimethyl-3-prop-1-en-2-ylhepta-2,4,6-trien-1-imine;ethane |
| SMILES | C=C/C(F)=C(Cl)\C(C(=C)C)=C(C)\C=N\C.CC |
| InChI | InChI=1S/C12H15ClFN.C2H6/c1-6-10(14)12(13)11(8(2)3)9(4)7-15-5;1-2/h6-7H,1-2H2,3-5H3;1-2H3/b11-9+,12-10-,15-7+; |
| InChIKey | VFCWPWWYUUREPD-FTLMHIRFSA-N |
| XLogP | 5.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.78 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|