C14H20ClF — CID 169127725
(3Z,5Z)-4-chloro-6-ethyl-3-fluoro-7-methyl-5-prop-1-en-2-ylocta-1,3,5-triene (PubChem CID 169127725) has the molecular formula C14H20ClF and a molecular weight of 242.76 g/mol. Its IUPAC name is (3Z,5Z)-4-chloro-6-ethyl-3-fluoro-7-methyl-5-prop-1-en-2-ylocta-1,3,5-triene.
| Compound Name | (3Z,5Z)-4-chloro-6-ethyl-3-fluoro-7-methyl-5-prop-1-en-2-ylocta-1,3,5-triene |
|---|---|
| PubChem CID | 169127725 |
| Molecular Formula | C14H20ClF |
| Molecular Weight | 242.76 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3Z,5Z)-4-chloro-6-ethyl-3-fluoro-7-methyl-5-prop-1-en-2-ylocta-1,3,5-triene |
| SMILES | C=C/C(F)=C(Cl)\C(C(=C)C)=C(\CC)C(C)C |
| InChI | InChI=1S/C14H20ClF/c1-7-11(9(3)4)13(10(5)6)14(15)12(16)8-2/h8-9H,2,5,7H2,1,3-4,6H3/b13-11-,14-12- |
| InChIKey | PGKAOTBSWOYVGK-XSYHWHKQSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.76 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|